C9H9N5O3S — CID 3359596
2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate (PubChem CID 3359596) has the molecular formula C9H9N5O3S and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate.
| Compound Name | 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate |
|---|---|
| PubChem CID | 3359596 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate |
| SMILES | NC(=O)OCCSc1nnc(-c2cnccn2)o1 |
| InChI | InChI=1S/C9H9N5O3S/c10-8(15)16-3-4-18-9-14-13-7(17-9)6-5-11-1-2-12-6/h1-2,5H,3-4H2,(H2,10,15) |
| InChIKey | RUFDLVKWOCJENH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|