About 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate
2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate (PubChem CID 3359596) has the molecular formula C9H9N5O3S
and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate |
| PubChem CID | 3359596 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate |
| SMILES | NC(=O)OCCSc1nnc(-c2cnccn2)o1 |
| InChI | InChI=1S/C9H9N5O3S/c10-8(15)16-3-4-18-9-14-13-7(17-9)6-5-11-1-2-12-6/h1-2,5H,3-4H2,(H2,10,15) |
| InChIKey | RUFDLVKWOCJENH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate?
The IUPAC name of 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate (CID 3359596) is 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate.
What is the SMILES notation for 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate?
The canonical SMILES for 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate is NC(=O)OCCSc1nnc(-c2cnccn2)o1.
What is the InChIKey of 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate?
The InChIKey is RUFDLVKWOCJENH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5O3S/c10-8(15)16-3-4-18-9-14-13-7(17-9)6-5-11-1-2-12-6/h1-2,5H,3-4H2,(H2,10,15).
What are the key properties of 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate?
2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate has a molecular weight of 267.27 g/mol, XLogP of 0.71, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl carbamate is sourced from PubChem (CID 3359596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).