C24H25N5O5 — CID 3365848
4-(2,2-dimethylpropanoylamino)-N-[[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide (PubChem CID 3365848) has the molecular formula C24H25N5O5 and a molecular weight of 463.49 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoylamino)-N-[[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide.
| Compound Name | 4-(2,2-dimethylpropanoylamino)-N-[[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3365848 |
| Molecular Formula | C24H25N5O5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-(2,2-dimethylpropanoylamino)-N-[[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide |
| SMILES | Cc1ccccc1N1C(=O)NC(=O)C(C=NNC(=O)c2ccc(NC(=O)C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C24H25N5O5/c1-14-7-5-6-8-18(14)29-21(32)17(20(31)27-23(29)34)13-25-28-19(30)15-9-11-16(12-10-15)26-22(33)24(2,3)4/h5-13,17H,1-4H3,(H,26,33)(H,28,30)(H,27,31,34) |
| InChIKey | AAURXNMEVUFGSZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|