C26H21N5O6 — CID 124554062
4-benzamido-N-[(Z)-[(5R)-1-(3-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide (PubChem CID 124554062) has the molecular formula C26H21N5O6 and a molecular weight of 499.48 g/mol. Its IUPAC name is 4-benzamido-N-[(Z)-[(5R)-1-(3-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide.
| Compound Name | 4-benzamido-N-[(Z)-[(5R)-1-(3-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 124554062 |
| Molecular Formula | C26H21N5O6 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 4-benzamido-N-[(Z)-[(5R)-1-(3-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzamide |
| SMILES | COc1cccc(N2C(=O)NC(=O)[C@@H](/C=N\NC(=O)c3ccc(NC(=O)c4ccccc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C26H21N5O6/c1-37-20-9-5-8-19(14-20)31-25(35)21(24(34)29-26(31)36)15-27-30-23(33)17-10-12-18(13-11-17)28-22(32)16-6-3-2-4-7-16/h2-15,21H,1H3,(H,28,32)(H,30,33)(H,29,34,36)/b27-15-/t21-/m1/s1 |
| InChIKey | SHOQDFHQGCOVGP-LZUVTCDBSA-N |
| XLogP | 2.56 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|