C17H14N4O6 — CID 124548664
N-[(Z)-[(5R)-1-(3-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]furan-2-carboxamide (PubChem CID 124548664) has the molecular formula C17H14N4O6 and a molecular weight of 370.32 g/mol. Its IUPAC name is N-[(Z)-[(5R)-1-(3-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(Z)-[(5R)-1-(3-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 124548664 |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-[(Z)-[(5R)-1-(3-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]furan-2-carboxamide |
| SMILES | COc1cccc(N2C(=O)NC(=O)[C@@H](/C=N\NC(=O)c3ccco3)C2=O)c1 |
| InChI | InChI=1S/C17H14N4O6/c1-26-11-5-2-4-10(8-11)21-16(24)12(14(22)19-17(21)25)9-18-20-15(23)13-6-3-7-27-13/h2-9,12H,1H3,(H,20,23)(H,19,22,25)/b18-9-/t12-/m1/s1 |
| InChIKey | KHVHSCFEGFKIMQ-HALGXTDHSA-N |
| XLogP | 0.90 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|