C20H22N4O4 — CID 4317336
N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-methylbenzamide (PubChem CID 4317336) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-methylbenzamide.
| Compound Name | N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 4317336 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NN=CC2C(=O)NC(=O)N(C3CC4CCC3C4)C2=O)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-11-2-5-13(6-3-11)17(25)23-21-10-15-18(26)22-20(28)24(19(15)27)16-9-12-4-7-14(16)8-12/h2-3,5-6,10,12,14-16H,4,7-9H2,1H3,(H,23,25)(H,22,26,28) |
| InChIKey | VNLYQISRZILDHJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|