C12H11N3O4 — CID 3367770
N-(2,4-dioxo-1H-pyrimidin-6-yl)-4-methoxybenzamide (PubChem CID 3367770) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-6-yl)-4-methoxybenzamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-6-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 3367770 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-6-yl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(=O)[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C12H11N3O4/c1-19-8-4-2-7(3-5-8)11(17)13-9-6-10(16)15-12(18)14-9/h2-6H,1H3,(H3,13,14,15,16,17,18) |
| InChIKey | UAHBREXOZYYRQE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |