C25H23N3O4S — CID 3368462
naphthalen-2-ylmethyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3368462) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is naphthalen-2-ylmethyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | naphthalen-2-ylmethyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3368462 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | naphthalen-2-ylmethyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | COc1ccc(/N=C(\SCc2ccc3ccccc3c2)c2c(O)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-27-23(29)21(24(30)28(2)25(27)31)22(26-19-10-12-20(32-3)13-11-19)33-15-16-8-9-17-6-4-5-7-18(17)14-16/h4-14,29H,15H2,1-3H3/b26-22- |
| InChIKey | JPDXDNYIZQISSD-ROMGYVFFSA-N |
| XLogP | 3.96 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|