C16H19N3O4S — CID 3894558
ethyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3894558) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is ethyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | ethyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3894558 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | ethyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | CCS/C(=N\c1ccc(OC)cc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H19N3O4S/c1-5-24-13(17-10-6-8-11(23-4)9-7-10)12-14(20)18(2)16(22)19(3)15(12)21/h6-9,20H,5H2,1-4H3/b17-13- |
| InChIKey | ORFVKRJYUWBPIP-LGMDPLHJSA-N |
| XLogP | 1.63 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|