C17H15N3O4S — CID 3859051
6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]-1-(thiophen-2-ylmethyl)pyrimidine-2,4-dione (PubChem CID 3859051) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is 6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]-1-(thiophen-2-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]-1-(thiophen-2-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3859051 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]-1-(thiophen-2-ylmethyl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(/N=C/c2c(O)n(Cc3cccs3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H15N3O4S/c1-24-12-6-4-11(5-7-12)18-9-14-15(21)19-17(23)20(16(14)22)10-13-3-2-8-25-13/h2-9,22H,10H2,1H3,(H,19,21,23)/b18-9+ |
| InChIKey | JPKCLMUUBRAQQL-GIJQJNRQSA-N |
| XLogP | 2.11 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|