C19H24N4O5S — CID 3533200
[2-oxo-2-(propylamino)ethyl] 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3533200) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-oxo-2-(propylamino)ethyl] 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3533200 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | CCCNC(=O)CS/C(=N\c1ccc(OC)cc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C19H24N4O5S/c1-5-10-20-14(24)11-29-16(21-12-6-8-13(28-4)9-7-12)15-17(25)22(2)19(27)23(3)18(15)26/h6-9,25H,5,10-11H2,1-4H3,(H,20,24)/b21-16- |
| InChIKey | FANGBTVSLYKNIV-PGMHBOJBSA-N |
| XLogP | 1.14 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|