C18H17N3O4S — CID 1275799
1-(4-ethoxyphenyl)-6-hydroxy-5-(thiophen-2-ylmethyliminomethyl)pyrimidine-2,4-dione (PubChem CID 1275799) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-6-hydroxy-5-(thiophen-2-ylmethyliminomethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(4-ethoxyphenyl)-6-hydroxy-5-(thiophen-2-ylmethyliminomethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1275799 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-(4-ethoxyphenyl)-6-hydroxy-5-(thiophen-2-ylmethyliminomethyl)pyrimidine-2,4-dione |
| SMILES | CCOc1ccc(-n2c(O)c(/C=N/Cc3cccs3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-2-25-13-7-5-12(6-8-13)21-17(23)15(16(22)20-18(21)24)11-19-10-14-4-3-9-26-14/h3-9,11,23H,2,10H2,1H3,(H,20,22,24)/b19-11+ |
| InChIKey | NCXCOGGCZLOEFA-YBFXNURJSA-N |
| XLogP | 2.31 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|