C16H13N3O2S2 — CID 829985
(2R)-3-(4-methoxyphenyl)-6-oxo-4-sulfanyl-2-thiophen-2-yl-1,2-dihydropyrimidine-5-carbonitrile (PubChem CID 829985) has the molecular formula C16H13N3O2S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2R)-3-(4-methoxyphenyl)-6-oxo-4-sulfanyl-2-thiophen-2-yl-1,2-dihydropyrimidine-5-carbonitrile.
| Compound Name | (2R)-3-(4-methoxyphenyl)-6-oxo-4-sulfanyl-2-thiophen-2-yl-1,2-dihydropyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 829985 |
| Molecular Formula | C16H13N3O2S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | (2R)-3-(4-methoxyphenyl)-6-oxo-4-sulfanyl-2-thiophen-2-yl-1,2-dihydropyrimidine-5-carbonitrile |
| SMILES | COc1ccc(N2C(S)=C(C#N)C(=O)N[C@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C16H13N3O2S2/c1-21-11-6-4-10(5-7-11)19-14(13-3-2-8-23-13)18-15(20)12(9-17)16(19)22/h2-8,14,22H,1H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | QDXYWUYNJODACL-CQSZACIVSA-N |
| XLogP | 3.06 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|