C17H19N3O4S — CID 3413387
prop-2-enyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3413387) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is prop-2-enyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | prop-2-enyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3413387 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | prop-2-enyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | C=CCS/C(=N\c1ccc(OC)cc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C17H19N3O4S/c1-5-10-25-14(18-11-6-8-12(24-4)9-7-11)13-15(21)19(2)17(23)20(3)16(13)22/h5-9,21H,1,10H2,2-4H3/b18-14- |
| InChIKey | FOCZSIPKPVTFAF-JXAWBTAJSA-N |
| XLogP | 1.80 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|