C12H12N4O3S3 — CID 3368582
2,3-dimethoxy-N-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamothioyl]benzamide (PubChem CID 3368582) has the molecular formula C12H12N4O3S3 and a molecular weight of 356.45 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3368582 |
| Molecular Formula | C12H12N4O3S3 |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2,3-dimethoxy-N-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamothioyl]benzamide |
| SMILES | COc1cccc(C(=O)NC(=S)Nc2n[nH]c(=S)s2)c1OC |
| InChI | InChI=1S/C12H12N4O3S3/c1-18-7-5-3-4-6(8(7)19-2)9(17)13-10(20)14-11-15-16-12(21)22-11/h3-5H,1-2H3,(H,16,21)(H2,13,14,15,17,20) |
| InChIKey | URWHHDNHFPMGDW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|