C20H28N6 — CID 3368645
N-(3-cyclohexyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)-4,6,7-trimethylquinazolin-2-amine (PubChem CID 3368645) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is N-(3-cyclohexyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)-4,6,7-trimethylquinazolin-2-amine.
| Compound Name | N-(3-cyclohexyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)-4,6,7-trimethylquinazolin-2-amine |
|---|---|
| PubChem CID | 3368645 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-(3-cyclohexyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)-4,6,7-trimethylquinazolin-2-amine |
| SMILES | Cc1cc2nc(NC3=NCN(C4CCCCC4)CN3)nc(C)c2cc1C |
| InChI | InChI=1S/C20H28N6/c1-13-9-17-15(3)23-20(24-18(17)10-14(13)2)25-19-21-11-26(12-22-19)16-7-5-4-6-8-16/h9-10,16H,4-8,11-12H2,1-3H3,(H2,21,22,23,24,25) |
| InChIKey | WVLSNZDDRPMKDR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |