C24H30N6O2 — CID 17337058
N-[3-[2-(3,4-dimethoxyphenyl)ethyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]-4,6,7-trimethylquinazolin-2-amine (PubChem CID 17337058) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-[2-(3,4-dimethoxyphenyl)ethyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]-4,6,7-trimethylquinazolin-2-amine.
| Compound Name | N-[3-[2-(3,4-dimethoxyphenyl)ethyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]-4,6,7-trimethylquinazolin-2-amine |
|---|---|
| PubChem CID | 17337058 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[3-[2-(3,4-dimethoxyphenyl)ethyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]-4,6,7-trimethylquinazolin-2-amine |
| SMILES | COc1ccc(CCN2CN=C(Nc3nc(C)c4cc(C)c(C)cc4n3)NC2)cc1OC |
| InChI | InChI=1S/C24H30N6O2/c1-15-10-19-17(3)27-24(28-20(19)11-16(15)2)29-23-25-13-30(14-26-23)9-8-18-6-7-21(31-4)22(12-18)32-5/h6-7,10-12H,8-9,13-14H2,1-5H3,(H2,25,26,27,28,29) |
| InChIKey | YVLYMACKBAUGSH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |