C25H35N3O2S — CID 2806555
3-[2-(3,4-dimethoxyphenyl)ethyl]-6-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-2,4-dihydro-1H-1,3,5-triazine (PubChem CID 2806555) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-6-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-2,4-dihydro-1H-1,3,5-triazine.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-6-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-2,4-dihydro-1H-1,3,5-triazine |
|---|---|
| PubChem CID | 2806555 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-6-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-2,4-dihydro-1H-1,3,5-triazine |
| SMILES | COc1ccc(CCN2CN=C(SCc3c(C)c(C)c(C)c(C)c3C)NC2)cc1OC |
| InChI | InChI=1S/C25H35N3O2S/c1-16-17(2)19(4)22(20(5)18(16)3)13-31-25-26-14-28(15-27-25)11-10-21-8-9-23(29-6)24(12-21)30-7/h8-9,12H,10-11,13-15H2,1-7H3,(H,26,27) |
| InChIKey | SLXJPKFYQUGMKQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |