C40H48F2N2O4 — CID 3371106
(3,4-difluorophenyl)-[5,13-dihydroxy-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 3371106) has the molecular formula C40H48F2N2O4 and a molecular weight of 658.83 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5,13-dihydroxy-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[5,13-dihydroxy-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 3371106 |
| Molecular Formula | C40H48F2N2O4 |
| Molecular Weight | 658.83 g/mol |
| Exact Mass | 658.36 |
| IUPAC Name | (3,4-difluorophenyl)-[5,13-dihydroxy-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | COc1ccccc1N1CCN(CC2(O)CCC3C45C=CC6(C=C4C(=O)c4ccc(F)c(F)c4)CC(O)CCC6(C)C5CCC32C)CC1 |
| InChI | InChI=1S/C40H48F2N2O4/c1-36-13-10-27(45)23-38(36)16-17-40(28(24-38)35(46)26-8-9-29(41)30(42)22-26)33(36)11-14-37(2)34(40)12-15-39(37,47)25-43-18-20-44(21-19-43)31-6-4-5-7-32(31)48-3/h4-9,16-17,22,24,27,33-34,45,47H,10-15,18-21,23,25H2,1-3H3 |
| InChIKey | KEWLPKDTTGQWPR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|