C41H49F3N2O4 — CID 3371108
[5,13-dihydroxy-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 3371108) has the molecular formula C41H49F3N2O4 and a molecular weight of 690.85 g/mol. Its IUPAC name is [5,13-dihydroxy-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5,13-dihydroxy-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 3371108 |
| Molecular Formula | C41H49F3N2O4 |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.36 |
| IUPAC Name | [5,13-dihydroxy-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | COc1ccccc1N1CCN(CC2(O)CCC3C45C=CC6(C=C4C(=O)c4cccc(C(F)(F)F)c4)CC(O)CCC6(C)C5CCC32C)CC1 |
| InChI | InChI=1S/C41H49F3N2O4/c1-36-14-11-29(47)24-38(36)17-18-40(30(25-38)35(48)27-7-6-8-28(23-27)41(42,43)44)33(36)12-15-37(2)34(40)13-16-39(37,49)26-45-19-21-46(22-20-45)31-9-4-5-10-32(31)50-3/h4-10,17-18,23,25,29,33-34,47,49H,11-16,19-22,24,26H2,1-3H3 |
| InChIKey | LOGSRXUHUJZRGY-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|