C16H14BrN3O4S — CID 3373236
3-bromo-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]-4-methylbenzamide (PubChem CID 3373236) has the molecular formula C16H14BrN3O4S and a molecular weight of 424.28 g/mol. Its IUPAC name is 3-bromo-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]-4-methylbenzamide.
| Compound Name | 3-bromo-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3373236 |
| Molecular Formula | C16H14BrN3O4S |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | 3-bromo-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]-4-methylbenzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=S)NC(=O)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C16H14BrN3O4S/c1-9-3-4-10(7-12(9)17)15(21)19-16(25)18-13-8-11(20(22)23)5-6-14(13)24-2/h3-8H,1-2H3,(H2,18,19,21,25) |
| InChIKey | PISZNGZPVBPUOQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|