C17H19NO — CID 3373593
N,N-dimethyl-3,3-diphenylpropanamide (PubChem CID 3373593) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is N,N-dimethyl-3,3-diphenylpropanamide.
| Compound Name | N,N-dimethyl-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 3373593 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N,N-dimethyl-3,3-diphenylpropanamide |
| SMILES | CN(C)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO/c1-18(2)17(19)13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16H,13H2,1-2H3 |
| InChIKey | PIOVSBYHSAZJCP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |