C15H12Cl2N2O2S — CID 3375069
N-[(3,5-dichlorophenyl)carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 3375069) has the molecular formula C15H12Cl2N2O2S and a molecular weight of 355.25 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | N-[(3,5-dichlorophenyl)carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3375069 |
| Molecular Formula | C15H12Cl2N2O2S |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | N-[(3,5-dichlorophenyl)carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)NC(=S)Nc2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C15H12Cl2N2O2S/c1-9-2-3-13(21-9)4-5-14(20)19-15(22)18-12-7-10(16)6-11(17)8-12/h2-8H,1H3,(H2,18,19,20,22) |
| InChIKey | FTGIZYREWZCSBU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|