C24H32N3O3+ — CID 3378023
5-butyl-1-(2-methylpropyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione (PubChem CID 3378023) has the molecular formula C24H32N3O3+ and a molecular weight of 410.54 g/mol. Its IUPAC name is 5-butyl-1-(2-methylpropyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione.
| Compound Name | 5-butyl-1-(2-methylpropyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 3378023 |
| Molecular Formula | C24H32N3O3+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 5-butyl-1-(2-methylpropyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione |
| SMILES | C=CCN1C(=O)C2([NH2+]C(CC(C)C)C3C(=O)N(CCCC)C(=O)C32)c2ccccc21 |
| InChI | InChI=1S/C24H31N3O3/c1-5-7-13-27-21(28)19-17(14-15(3)4)25-24(20(19)22(27)29)16-10-8-9-11-18(16)26(12-6-2)23(24)30/h6,8-11,15,17,19-20,25H,2,5,7,12-14H2,1,3-4H3/p+1 |
| InChIKey | CCPFXTOFIDHMBG-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 74.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|