C20H24N3O3S+ — CID 11896951
(1R,3S,3aR,6aR)-5-methyl-1-(2-methylsulfanylethyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione (PubChem CID 11896951) has the molecular formula C20H24N3O3S+ and a molecular weight of 386.50 g/mol. Its IUPAC name is (1R,3S,3aR,6aR)-5-methyl-1-(2-methylsulfanylethyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aR)-5-methyl-1-(2-methylsulfanylethyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 11896951 |
| Molecular Formula | C20H24N3O3S+ |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (1R,3S,3aR,6aR)-5-methyl-1-(2-methylsulfanylethyl)-1'-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione |
| SMILES | C=CCN1C(=O)[C@@]2([NH2+][C@H](CCSC)[C@@H]3C(=O)N(C)C(=O)[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C20H23N3O3S/c1-4-10-23-14-8-6-5-7-12(14)20(19(23)26)16-15(13(21-20)9-11-27-3)17(24)22(2)18(16)25/h4-8,13,15-16,21H,1,9-11H2,2-3H3/p+1/t13-,15+,16+,20-/m1/s1 |
| InChIKey | FXAUMZXMMDRHJZ-WJCADGGCSA-O |
| XLogP | 0.34 |
| TPSA | 74.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|