C7HCl4NO — CID 3378601
1,2,4,5-tetrachloro-3-isocyanatobenzene (PubChem CID 3378601) has the molecular formula C7HCl4NO and a molecular weight of 256.90 g/mol. Its IUPAC name is 1,2,4,5-tetrachloro-3-isocyanatobenzene.
| Compound Name | 1,2,4,5-tetrachloro-3-isocyanatobenzene |
|---|---|
| PubChem CID | 3378601 |
| Molecular Formula | C7HCl4NO |
| Molecular Weight | 256.90 g/mol |
| Exact Mass | 254.88 |
| IUPAC Name | 1,2,4,5-tetrachloro-3-isocyanatobenzene |
| SMILES | O=C=Nc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C7HCl4NO/c8-3-1-4(9)6(11)7(5(3)10)12-2-13/h1H |
| InChIKey | GQWLHPWGYHTUAS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|