C6H3Cl4N — CID 3013925
2,3,4,6-tetrachloroaniline (PubChem CID 3013925) has the molecular formula C6H3Cl4N and a molecular weight of 230.91 g/mol. Its IUPAC name is 2,3,4,6-tetrachloroaniline.
| Compound Name | 2,3,4,6-tetrachloroaniline |
|---|---|
| PubChem CID | 3013925 |
| Molecular Formula | C6H3Cl4N |
| Molecular Weight | 230.91 g/mol |
| Exact Mass | 228.90 |
| IUPAC Name | 2,3,4,6-tetrachloroaniline |
| SMILES | Nc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6H3Cl4N/c7-2-1-3(8)6(11)5(10)4(2)9/h1H,11H2 |
| InChIKey | LXCLPHJRGDTDDB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.91 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|