C23H18Cl3N3O2 — CID 3380851
2,4,5-trichloro-6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-3-carbonitrile (PubChem CID 3380851) has the molecular formula C23H18Cl3N3O2 and a molecular weight of 474.78 g/mol. Its IUPAC name is 2,4,5-trichloro-6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2,4,5-trichloro-6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3380851 |
| Molecular Formula | C23H18Cl3N3O2 |
| Molecular Weight | 474.78 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 2,4,5-trichloro-6-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-3-carbonitrile |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)N(c1nc(Cl)c(C#N)c(Cl)c1Cl)CC2 |
| InChI | InChI=1S/C23H18Cl3N3O2/c1-30-17-10-14-8-9-29(23-20(25)19(24)16(12-27)22(26)28-23)21(13-6-4-3-5-7-13)15(14)11-18(17)31-2/h3-7,10-11,21H,8-9H2,1-2H3 |
| InChIKey | ZBFSUHKGVJOPCK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.78 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|