C21H19BrN2O2S — CID 3382204
N-[benzyl(methyl)carbamothioyl]-2-(1-bromonaphthalen-2-yl)oxyacetamide (PubChem CID 3382204) has the molecular formula C21H19BrN2O2S and a molecular weight of 443.37 g/mol. Its IUPAC name is N-[benzyl(methyl)carbamothioyl]-2-(1-bromonaphthalen-2-yl)oxyacetamide.
| Compound Name | N-[benzyl(methyl)carbamothioyl]-2-(1-bromonaphthalen-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 3382204 |
| Molecular Formula | C21H19BrN2O2S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | N-[benzyl(methyl)carbamothioyl]-2-(1-bromonaphthalen-2-yl)oxyacetamide |
| SMILES | CN(Cc1ccccc1)C(=S)NC(=O)COc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C21H19BrN2O2S/c1-24(13-15-7-3-2-4-8-15)21(27)23-19(25)14-26-18-12-11-16-9-5-6-10-17(16)20(18)22/h2-12H,13-14H2,1H3,(H,23,25,27) |
| InChIKey | XXRXJVWWNQNYAV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|