C18H15BrN2O4S — CID 3387456
N'-(benzenesulfonyl)-2-(1-bromonaphthalen-2-yl)oxyacetohydrazide (PubChem CID 3387456) has the molecular formula C18H15BrN2O4S and a molecular weight of 435.30 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2-(1-bromonaphthalen-2-yl)oxyacetohydrazide.
| Compound Name | N'-(benzenesulfonyl)-2-(1-bromonaphthalen-2-yl)oxyacetohydrazide |
|---|---|
| PubChem CID | 3387456 |
| Molecular Formula | C18H15BrN2O4S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | N'-(benzenesulfonyl)-2-(1-bromonaphthalen-2-yl)oxyacetohydrazide |
| SMILES | O=C(COc1ccc2ccccc2c1Br)NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15BrN2O4S/c19-18-15-9-5-4-6-13(15)10-11-16(18)25-12-17(22)20-21-26(23,24)14-7-2-1-3-8-14/h1-11,21H,12H2,(H,20,22) |
| InChIKey | GGAJHXTWGFBCME-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|