C15H17N5O4S — CID 3386775
N-(2,5-diethoxyphenyl)-2-([1,2,4]triazolo[3,4-b][1,3,4]oxadiazol-6-ylsulfanyl)acetamide (PubChem CID 3386775) has the molecular formula C15H17N5O4S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2-([1,2,4]triazolo[3,4-b][1,3,4]oxadiazol-6-ylsulfanyl)acetamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2-([1,2,4]triazolo[3,4-b][1,3,4]oxadiazol-6-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 3386775 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2-([1,2,4]triazolo[3,4-b][1,3,4]oxadiazol-6-ylsulfanyl)acetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CSc2nn3cnnc3o2)c1 |
| InChI | InChI=1S/C15H17N5O4S/c1-3-22-10-5-6-12(23-4-2)11(7-10)17-13(21)8-25-15-19-20-9-16-18-14(20)24-15/h5-7,9H,3-4,8H2,1-2H3,(H,17,21) |
| InChIKey | PLUQYLFUYPVCBW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |