C25H26N3O3+ — CID 3388238
7-[(4-ethoxy-3-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-1-ium-8-ol (PubChem CID 3388238) has the molecular formula C25H26N3O3+ and a molecular weight of 416.50 g/mol. Its IUPAC name is 7-[(4-ethoxy-3-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-1-ium-8-ol.
| Compound Name | 7-[(4-ethoxy-3-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-1-ium-8-ol |
|---|---|
| PubChem CID | 3388238 |
| Molecular Formula | C25H26N3O3+ |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 7-[(4-ethoxy-3-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-1-ium-8-ol |
| SMILES | CCOc1ccc(C(Nc2cc(C)ccn2)c2ccc3ccc[nH+]c3c2O)cc1OC |
| InChI | InChI=1S/C25H25N3O3/c1-4-31-20-10-8-18(15-21(20)30-3)23(28-22-14-16(2)11-13-26-22)19-9-7-17-6-5-12-27-24(17)25(19)29/h5-15,23,29H,4H2,1-3H3,(H,26,28)/p+1 |
| InChIKey | XVTIDQOMNUCNHZ-UHFFFAOYSA-O |
| XLogP | 4.67 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|