C17H12Br2ClNO2 — CID 3392829
2-(2-chlorophenyl)-3-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)prop-2-enenitrile (PubChem CID 3392829) has the molecular formula C17H12Br2ClNO2 and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(2-chlorophenyl)-3-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3392829 |
| Molecular Formula | C17H12Br2ClNO2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 454.89 |
| IUPAC Name | 2-(2-chlorophenyl)-3-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(C=C(C#N)c2ccccc2Cl)c(Br)c(Br)c1O |
| InChI | InChI=1S/C17H12Br2ClNO2/c1-2-23-14-8-10(15(18)16(19)17(14)22)7-11(9-21)12-5-3-4-6-13(12)20/h3-8,22H,2H2,1H3 |
| InChIKey | ATFUNVWMMPQAHV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|