C21H22FNO — CID 124550621
(E)-3-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-2-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 124550621) has the molecular formula C21H22FNO and a molecular weight of 323.41 g/mol. Its IUPAC name is (E)-3-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-2-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-2-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124550621 |
| Molecular Formula | C21H22FNO |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (E)-3-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-2-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(C)c(/C=C(/C#N)c2ccccc2F)cc1C(C)C |
| InChI | InChI=1S/C21H22FNO/c1-5-24-21-10-15(4)16(12-19(21)14(2)3)11-17(13-23)18-8-6-7-9-20(18)22/h6-12,14H,5H2,1-4H3/b17-11- |
| InChIKey | CJYDQHFOFHHFEK-BOPFTXTBSA-N |
| XLogP | 5.72 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|