C19H18FNO2 — CID 3982894
3-(2,4-diethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 3982894) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-(2,4-diethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | 3-(2,4-diethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3982894 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-(2,4-diethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | CCOc1ccc(C=C(C#N)c2ccccc2F)c(OCC)c1 |
| InChI | InChI=1S/C19H18FNO2/c1-3-22-16-10-9-14(19(12-16)23-4-2)11-15(13-21)17-7-5-6-8-18(17)20/h5-12H,3-4H2,1-2H3 |
| InChIKey | XSXRAHDMFGFODO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|