C22H38N2 — CID 3396601
N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 3396601) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 3396601 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(NCCCN(C)C)c1cc(C(C)(C)C)cc2c1CCC2(C)C |
| InChI | InChI=1S/C22H38N2/c1-16(23-12-9-13-24(7)8)19-14-17(21(2,3)4)15-20-18(19)10-11-22(20,5)6/h14-16,23H,9-13H2,1-8H3 |
| InChIKey | PZEUCIVVVWVHAI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|