C18H15BrN4O2 — CID 3396919
3-(2-bromophenyl)-1-ethyl-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3396919) has the molecular formula C18H15BrN4O2 and a molecular weight of 399.25 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-ethyl-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 3-(2-bromophenyl)-1-ethyl-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3396919 |
| Molecular Formula | C18H15BrN4O2 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 3-(2-bromophenyl)-1-ethyl-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(CC)OC(c3ccccc3Br)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C18H15BrN4O2/c1-3-18-11(2)17(10-22,15(23)25-18)16(8-20,9-21)14(24-18)12-6-4-5-7-13(12)19/h4-7,11,14,23H,3H2,1-2H3/b23-15- |
| InChIKey | KTYJMYKFVHMCQK-HAHDFKILSA-N |
| XLogP | 3.81 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|