C29H28N4O3 — CID 3398534
5-(4-tert-butylphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 3398534) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-tert-butylphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3398534 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 5-(4-tert-butylphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | Cc1nc2ccccn2c1C(O)=C1C(=O)C(=O)N(Cc2cccnc2)C1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H28N4O3/c1-18-24(32-15-6-5-9-22(32)31-18)26(34)23-25(20-10-12-21(13-11-20)29(2,3)4)33(28(36)27(23)35)17-19-8-7-14-30-16-19/h5-16,25,34H,17H2,1-4H3 |
| InChIKey | HXLILRHUUSRHIL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|