C33H28N4O5 — CID 6188580
(4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 6188580) has the molecular formula C33H28N4O5 and a molecular weight of 560.61 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6188580 |
| Molecular Formula | C33H28N4O5 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | (4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3c(C)nc4ccccn34)C(=O)C(=O)N2Cc2cccnc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H28N4O5/c1-21-29(36-16-7-6-12-27(36)35-21)31(38)28-30(37(33(40)32(28)39)19-23-11-8-15-34-18-23)24-13-14-25(26(17-24)41-2)42-20-22-9-4-3-5-10-22/h3-18,30,38H,19-20H2,1-2H3/b31-28+ |
| InChIKey | INTQYNWIQLFHCO-CCFHIKDMSA-N |
| XLogP | 5.25 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|