C26H21BrN4O5 — CID 4695839
5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 4695839) has the molecular formula C26H21BrN4O5 and a molecular weight of 549.38 g/mol. Its IUPAC name is 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4695839 |
| Molecular Formula | C26H21BrN4O5 |
| Molecular Weight | 549.38 g/mol |
| Exact Mass | 548.07 |
| IUPAC Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3c(C)nc4ccccn34)C(=O)C(=O)N2Cc2cccnc2)cc(Br)c1O |
| InChI | InChI=1S/C26H21BrN4O5/c1-14-21(30-9-4-3-7-19(30)29-14)24(33)20-22(16-10-17(27)23(32)18(11-16)36-2)31(26(35)25(20)34)13-15-6-5-8-28-12-15/h3-12,22,32-33H,13H2,1-2H3 |
| InChIKey | QMAUNAIZCONZKF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|