C18H18BrIN2O2 — CID 3399843
3-bromo-4-tert-butyl-N'-(2-iodobenzoyl)benzohydrazide (PubChem CID 3399843) has the molecular formula C18H18BrIN2O2 and a molecular weight of 501.16 g/mol. Its IUPAC name is 3-bromo-4-tert-butyl-N'-(2-iodobenzoyl)benzohydrazide.
| Compound Name | 3-bromo-4-tert-butyl-N'-(2-iodobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 3399843 |
| Molecular Formula | C18H18BrIN2O2 |
| Molecular Weight | 501.16 g/mol |
| Exact Mass | 499.96 |
| IUPAC Name | 3-bromo-4-tert-butyl-N'-(2-iodobenzoyl)benzohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)NNC(=O)c2ccccc2I)cc1Br |
| InChI | InChI=1S/C18H18BrIN2O2/c1-18(2,3)13-9-8-11(10-14(13)19)16(23)21-22-17(24)12-6-4-5-7-15(12)20/h4-10H,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | FHDWKSLTCCNYJU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.16 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|