C17H18BrN3O2 — CID 4731414
N'-(2-bromobenzoyl)-2-tert-butylpyridine-4-carbohydrazide (PubChem CID 4731414) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is N'-(2-bromobenzoyl)-2-tert-butylpyridine-4-carbohydrazide.
| Compound Name | N'-(2-bromobenzoyl)-2-tert-butylpyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 4731414 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N'-(2-bromobenzoyl)-2-tert-butylpyridine-4-carbohydrazide |
| SMILES | CC(C)(C)c1cc(C(=O)NNC(=O)c2ccccc2Br)ccn1 |
| InChI | InChI=1S/C17H18BrN3O2/c1-17(2,3)14-10-11(8-9-19-14)15(22)20-21-16(23)12-6-4-5-7-13(12)18/h4-10H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | WOAWWXOPSQHCKE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|