C20H16N5O2+ — CID 3401799
6-(4-nitrophenyl)-2,4-diphenyl-3H-1,2,4,5-tetrazin-2-ium (PubChem CID 3401799) has the molecular formula C20H16N5O2+ and a molecular weight of 358.38 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-2,4-diphenyl-3H-1,2,4,5-tetrazin-2-ium.
| Compound Name | 6-(4-nitrophenyl)-2,4-diphenyl-3H-1,2,4,5-tetrazin-2-ium |
|---|---|
| PubChem CID | 3401799 |
| Molecular Formula | C20H16N5O2+ |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 6-(4-nitrophenyl)-2,4-diphenyl-3H-1,2,4,5-tetrazin-2-ium |
| SMILES | O=[N+]([O-])c1ccc(C2=NN(c3ccccc3)C[N+](c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C20H16N5O2/c26-25(27)19-13-11-16(12-14-19)20-21-23(17-7-3-1-4-8-17)15-24(22-20)18-9-5-2-6-10-18/h1-14H,15H2/q+1 |
| InChIKey | QSKXXWHZFQIGAB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|