C21H20N6O2 — CID 34044557
2-methyl-5-[4-(2-nitrophenyl)piperazin-1-yl]pyrazolo[1,5-a]quinazoline (PubChem CID 34044557) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-methyl-5-[4-(2-nitrophenyl)piperazin-1-yl]pyrazolo[1,5-a]quinazoline.
| Compound Name | 2-methyl-5-[4-(2-nitrophenyl)piperazin-1-yl]pyrazolo[1,5-a]quinazoline |
|---|---|
| PubChem CID | 34044557 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-methyl-5-[4-(2-nitrophenyl)piperazin-1-yl]pyrazolo[1,5-a]quinazoline |
| SMILES | Cc1cc2nc(N3CCN(c4ccccc4[N+](=O)[O-])CC3)c3ccccc3n2n1 |
| InChI | InChI=1S/C21H20N6O2/c1-15-14-20-22-21(16-6-2-3-7-17(16)26(20)23-15)25-12-10-24(11-13-25)18-8-4-5-9-19(18)27(28)29/h2-9,14H,10-13H2,1H3 |
| InChIKey | VRPQYWWYMDFPPV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|