C21H19ClN6O4S — CID 46644311
3-chloro-2-methyl-5-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrazolo[1,5-a]quinazoline (PubChem CID 46644311) has the molecular formula C21H19ClN6O4S and a molecular weight of 486.94 g/mol. Its IUPAC name is 3-chloro-2-methyl-5-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrazolo[1,5-a]quinazoline.
| Compound Name | 3-chloro-2-methyl-5-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrazolo[1,5-a]quinazoline |
|---|---|
| PubChem CID | 46644311 |
| Molecular Formula | C21H19ClN6O4S |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 3-chloro-2-methyl-5-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrazolo[1,5-a]quinazoline |
| SMILES | Cc1nn2c(nc(N3CCN(S(=O)(=O)c4cccc([N+](=O)[O-])c4)CC3)c3ccccc32)c1Cl |
| InChI | InChI=1S/C21H19ClN6O4S/c1-14-19(22)21-23-20(17-7-2-3-8-18(17)27(21)24-14)25-9-11-26(12-10-25)33(31,32)16-6-4-5-15(13-16)28(29)30/h2-8,13H,9-12H2,1H3 |
| InChIKey | HOZLZSWAFMBVGD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|