C23H26N2O3 — CID 34056983
(E)-N'-[2-(1-adamantyl)acetyl]-3-(1-benzofuran-2-yl)prop-2-enehydrazide (PubChem CID 34056983) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (E)-N'-[2-(1-adamantyl)acetyl]-3-(1-benzofuran-2-yl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(1-adamantyl)acetyl]-3-(1-benzofuran-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 34056983 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (E)-N'-[2-(1-adamantyl)acetyl]-3-(1-benzofuran-2-yl)prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1cc2ccccc2o1)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H26N2O3/c26-21(6-5-19-10-18-3-1-2-4-20(18)28-19)24-25-22(27)14-23-11-15-7-16(12-23)9-17(8-15)13-23/h1-6,10,15-17H,7-9,11-14H2,(H,24,26)(H,25,27)/b6-5+ |
| InChIKey | KDGSGHZVCDNOIP-AATRIKPKSA-N |
| XLogP | 4.20 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|