C19H20N2O4 — CID 3406198
2-(pyridine-4-carbonylamino)ethyl 2-(2-prop-2-enylphenoxy)acetate (PubChem CID 3406198) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-(pyridine-4-carbonylamino)ethyl 2-(2-prop-2-enylphenoxy)acetate.
| Compound Name | 2-(pyridine-4-carbonylamino)ethyl 2-(2-prop-2-enylphenoxy)acetate |
|---|---|
| PubChem CID | 3406198 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-(pyridine-4-carbonylamino)ethyl 2-(2-prop-2-enylphenoxy)acetate |
| SMILES | C=CCc1ccccc1OCC(=O)OCCNC(=O)c1ccncc1 |
| InChI | InChI=1S/C19H20N2O4/c1-2-5-15-6-3-4-7-17(15)25-14-18(22)24-13-12-21-19(23)16-8-10-20-11-9-16/h2-4,6-11H,1,5,12-14H2,(H,21,23) |
| InChIKey | NWTFDGOSKKHUNC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|