C23H45NO4 — CID 3407870
methyl 9-(3-hydroxy-4,4-dimethyl-2-octyl-1,3-oxazolidin-2-yl)nonanoate (PubChem CID 3407870) has the molecular formula C23H45NO4 and a molecular weight of 399.62 g/mol. Its IUPAC name is methyl 9-(3-hydroxy-4,4-dimethyl-2-octyl-1,3-oxazolidin-2-yl)nonanoate.
| Compound Name | methyl 9-(3-hydroxy-4,4-dimethyl-2-octyl-1,3-oxazolidin-2-yl)nonanoate |
|---|---|
| PubChem CID | 3407870 |
| Molecular Formula | C23H45NO4 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.33 |
| IUPAC Name | methyl 9-(3-hydroxy-4,4-dimethyl-2-octyl-1,3-oxazolidin-2-yl)nonanoate |
| SMILES | CCCCCCCCC1(CCCCCCCCC(=O)OC)OCC(C)(C)N1O |
| InChI | InChI=1S/C23H45NO4/c1-5-6-7-8-12-15-18-23(24(26)22(2,3)20-28-23)19-16-13-10-9-11-14-17-21(25)27-4/h26H,5-20H2,1-4H3 |
| InChIKey | YFPBHLCMDNSYBU-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|