C20H30N4O5S — CID 34083008
3,5-dimethoxy-N-[(2S)-3-methyl-1-oxo-1-[2-[[(2R)-oxolan-2-yl]methylcarbamothioyl]hydrazinyl]butan-2-yl]benzamide (PubChem CID 34083008) has the molecular formula C20H30N4O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(2S)-3-methyl-1-oxo-1-[2-[[(2R)-oxolan-2-yl]methylcarbamothioyl]hydrazinyl]butan-2-yl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(2S)-3-methyl-1-oxo-1-[2-[[(2R)-oxolan-2-yl]methylcarbamothioyl]hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 34083008 |
| Molecular Formula | C20H30N4O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 3,5-dimethoxy-N-[(2S)-3-methyl-1-oxo-1-[2-[[(2R)-oxolan-2-yl]methylcarbamothioyl]hydrazinyl]butan-2-yl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N[C@H](C(=O)NNC(=S)NC[C@H]2CCCO2)C(C)C)c1 |
| InChI | InChI=1S/C20H30N4O5S/c1-12(2)17(19(26)23-24-20(30)21-11-14-6-5-7-29-14)22-18(25)13-8-15(27-3)10-16(9-13)28-4/h8-10,12,14,17H,5-7,11H2,1-4H3,(H,22,25)(H,23,26)(H2,21,24,30)/t14-,17+/m1/s1 |
| InChIKey | AWLWUORIDQACFW-PBHICJAKSA-N |
| XLogP | 1.13 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|