C21H19N5O — CID 3408773
3-amino-4-(4-methylphenyl)-4,5,10,18-tetrazatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),2,5,12,14,16-hexaen-11-one (PubChem CID 3408773) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 3-amino-4-(4-methylphenyl)-4,5,10,18-tetrazatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),2,5,12,14,16-hexaen-11-one.
| Compound Name | 3-amino-4-(4-methylphenyl)-4,5,10,18-tetrazatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),2,5,12,14,16-hexaen-11-one |
|---|---|
| PubChem CID | 3408773 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-amino-4-(4-methylphenyl)-4,5,10,18-tetrazatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),2,5,12,14,16-hexaen-11-one |
| SMILES | Cc1ccc(-n2nc3c(c2N)-c2nc4ccccc4c(=O)n2CCC3)cc1 |
| InChI | InChI=1S/C21H19N5O/c1-13-8-10-14(11-9-13)26-19(22)18-17(24-26)7-4-12-25-20(18)23-16-6-3-2-5-15(16)21(25)27/h2-3,5-6,8-11H,4,7,12,22H2,1H3 |
| InChIKey | WTLLPGZTBOPWMY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |