C24H20N4O — CID 13381237
(6E)-6-[(4-phenylphenyl)hydrazinylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one (PubChem CID 13381237) has the molecular formula C24H20N4O and a molecular weight of 380.45 g/mol. Its IUPAC name is (6E)-6-[(4-phenylphenyl)hydrazinylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one.
| Compound Name | (6E)-6-[(4-phenylphenyl)hydrazinylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 13381237 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (6E)-6-[(4-phenylphenyl)hydrazinylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one |
| SMILES | O=c1c2ccccc2nc2n1CCC/C2=N\Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N4O/c29-24-20-9-4-5-10-21(20)25-23-22(11-6-16-28(23)24)27-26-19-14-12-18(13-15-19)17-7-2-1-3-8-17/h1-5,7-10,12-15,26H,6,11,16H2/b27-22+ |
| InChIKey | ADMRHFSDAANLNM-HPNDGRJYSA-N |
| XLogP | 4.67 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|